C25H26FN3O2S — CID 2087753
(2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 2087753) has the molecular formula C25H26FN3O2S and a molecular weight of 451.57 g/mol. Its IUPAC name is (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 2087753 |
| Molecular Formula | C25H26FN3O2S |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | C[C@@H](Sc1nc2ccccc2c(=O)n1-c1ccccc1F)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C25H26FN3O2S/c1-17(23(30)27-16-15-18-9-3-2-4-10-18)32-25-28-21-13-7-5-11-19(21)24(31)29(25)22-14-8-6-12-20(22)26/h5-9,11-14,17H,2-4,10,15-16H2,1H3,(H,27,30)/t17-/m1/s1 |
| InChIKey | ZZRGBMKEVSAELH-QGZVFWFLSA-N |
| XLogP | 5.01 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|