C22H27N3O2S — CID 8980500
(2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylpropanamide (PubChem CID 8980500) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8980500 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-(3-cyclopropyl-4-oxoquinazolin-2-yl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1nc2ccccc2c(=O)n1C1CC1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C22H27N3O2S/c1-15(20(26)23-14-13-16-7-3-2-4-8-16)28-22-24-19-10-6-5-9-18(19)21(27)25(22)17-11-12-17/h5-7,9-10,15,17H,2-4,8,11-14H2,1H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | GRGUOUBVUZRWPN-HNNXBMFYSA-N |
| XLogP | 4.22 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|