C27H29N3O4S — CID 2513090
3-benzyl-2-[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl]sulfanyl-4-oxoquinazoline-7-carboxylic acid (PubChem CID 2513090) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 3-benzyl-2-[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl]sulfanyl-4-oxoquinazoline-7-carboxylic acid.
| Compound Name | 3-benzyl-2-[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl]sulfanyl-4-oxoquinazoline-7-carboxylic acid |
|---|---|
| PubChem CID | 2513090 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 3-benzyl-2-[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl]sulfanyl-4-oxoquinazoline-7-carboxylic acid |
| SMILES | C[C@@H](Sc1nc2cc(C(=O)O)ccc2c(=O)n1Cc1ccccc1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C27H29N3O4S/c1-18(24(31)28-15-14-19-8-4-2-5-9-19)35-27-29-23-16-21(26(33)34)12-13-22(23)25(32)30(27)17-20-10-6-3-7-11-20/h3,6-8,10-13,16,18H,2,4-5,9,14-15,17H2,1H3,(H,28,31)(H,33,34)/t18-/m1/s1 |
| InChIKey | RGWAGJMRNGHWAV-GOSISDBHSA-N |
| XLogP | 4.63 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|