C22H25N3O3S — CID 8983530
(2S)-2-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxyethyl)propanamide (PubChem CID 8983530) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is (2S)-2-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxyethyl)propanamide.
| Compound Name | (2S)-2-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 8983530 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (2S)-2-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@H](C)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C |
| InChI | InChI=1S/C22H25N3O3S/c1-14-9-10-15(2)19(13-14)25-21(27)17-7-5-6-8-18(17)24-22(25)29-16(3)20(26)23-11-12-28-4/h5-10,13,16H,11-12H2,1-4H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | BPMUVMSVCHDRFJ-INIZCTEOSA-N |
| XLogP | 3.25 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|