C18H24N4O4S — CID 7803396
(2S)-N-carbamoyl-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-3-methylbutanamide (PubChem CID 7803396) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-3-methylbutanamide.
| Compound Name | (2S)-N-carbamoyl-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 7803396 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (2S)-N-carbamoyl-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-3-methylbutanamide |
| SMILES | COCCCn1c(S[C@H](C(=O)NC(N)=O)C(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H24N4O4S/c1-11(2)14(15(23)21-17(19)25)27-18-20-13-8-5-4-7-12(13)16(24)22(18)9-6-10-26-3/h4-5,7-8,11,14H,6,9-10H2,1-3H3,(H3,19,21,23,25)/t14-/m0/s1 |
| InChIKey | LDURKYBXHJIDJV-AWEZNQCLSA-N |
| XLogP | 1.74 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|