C20H28N4O3S — CID 7855393
(2S)-N-carbamoyl-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanyl-3-methylbutanamide (PubChem CID 7855393) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanyl-3-methylbutanamide.
| Compound Name | (2S)-N-carbamoyl-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 7855393 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (2S)-N-carbamoyl-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanyl-3-methylbutanamide |
| SMILES | CCCCCCn1c(S[C@H](C(=O)NC(N)=O)C(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H28N4O3S/c1-4-5-6-9-12-24-18(26)14-10-7-8-11-15(14)22-20(24)28-16(13(2)3)17(25)23-19(21)27/h7-8,10-11,13,16H,4-6,9,12H2,1-3H3,(H3,21,23,25,27)/t16-/m0/s1 |
| InChIKey | PVCLLCCPCAIZEY-INIZCTEOSA-N |
| XLogP | 3.29 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|