C19H21Br2N — CID 70638439
(E)-2,3-bis(4-bromophenyl)-N,N-diethylprop-2-en-1-amine (PubChem CID 70638439) has the molecular formula C19H21Br2N and a molecular weight of 423.19 g/mol. Its IUPAC name is (E)-2,3-bis(4-bromophenyl)-N,N-diethylprop-2-en-1-amine.
| Compound Name | (E)-2,3-bis(4-bromophenyl)-N,N-diethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 70638439 |
| Molecular Formula | C19H21Br2N |
| Molecular Weight | 423.19 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | (E)-2,3-bis(4-bromophenyl)-N,N-diethylprop-2-en-1-amine |
| SMILES | CCN(CC)C/C(=C/c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21Br2N/c1-3-22(4-2)14-17(16-7-11-19(21)12-8-16)13-15-5-9-18(20)10-6-15/h5-13H,3-4,14H2,1-2H3/b17-13- |
| InChIKey | XWCJGHJAFDNFLT-LGMDPLHJSA-N |
| XLogP | 6.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.19 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|