C24H30O2S2 — CID 102303025
(5Z,7Z)-5,8-bis(phenylsulfanyl)dodeca-5,7-diene-1,12-diol (PubChem CID 102303025) has the molecular formula C24H30O2S2 and a molecular weight of 414.64 g/mol. Its IUPAC name is (5Z,7Z)-5,8-bis(phenylsulfanyl)dodeca-5,7-diene-1,12-diol.
| Compound Name | (5Z,7Z)-5,8-bis(phenylsulfanyl)dodeca-5,7-diene-1,12-diol |
|---|---|
| PubChem CID | 102303025 |
| Molecular Formula | C24H30O2S2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (5Z,7Z)-5,8-bis(phenylsulfanyl)dodeca-5,7-diene-1,12-diol |
| SMILES | OCCCC/C(=C/C=C(/CCCCO)Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C24H30O2S2/c25-19-9-7-15-23(27-21-11-3-1-4-12-21)17-18-24(16-8-10-20-26)28-22-13-5-2-6-14-22/h1-6,11-14,17-18,25-26H,7-10,15-16,19-20H2/b23-17-,24-18- |
| InChIKey | YYQWFRQWODWCKA-BOYKQRMESA-N |
| XLogP | 6.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|