C27H21NS3 — CID 67543051
phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate (PubChem CID 67543051) has the molecular formula C27H21NS3 and a molecular weight of 455.67 g/mol. Its IUPAC name is phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate.
| Compound Name | phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate |
|---|---|
| PubChem CID | 67543051 |
| Molecular Formula | C27H21NS3 |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate |
| SMILES | C(Sc1ccccc1)=C(Sc1ccccc1)/C(=N\c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C27H21NS3/c1-5-13-22(14-6-1)28-27(31-25-19-11-4-12-20-25)26(30-24-17-9-3-10-18-24)21-29-23-15-7-2-8-16-23/h1-21H/b26-21?,28-27+ |
| InChIKey | FQXUQXFKARJVPE-WOJNGRSISA-N |
| XLogP | 8.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|