About phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate
phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate (PubChem CID 67543051) has the molecular formula C27H21NS3
and a molecular weight of 455.67 g/mol. Its IUPAC name is phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate.
Molecular Properties
| Compound Name | phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate |
| PubChem CID | 67543051 |
| Molecular Formula | C27H21NS3 |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate |
| SMILES | C(Sc1ccccc1)=C(Sc1ccccc1)/C(=N\c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C27H21NS3/c1-5-13-22(14-6-1)28-27(31-25-19-11-4-12-20-25)26(30-24-17-9-3-10-18-24)21-29-23-15-7-2-8-16-23/h1-21H/b26-21?,28-27+ |
| InChIKey | FQXUQXFKARJVPE-WOJNGRSISA-N |
| XLogP | 8.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate?
The IUPAC name of phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate (CID 67543051) is phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate.
What is the SMILES notation for phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate?
The canonical SMILES for phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate is C(Sc1ccccc1)=C(Sc1ccccc1)/C(=N\c1ccccc1)Sc1ccccc1.
What is the InChIKey of phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate?
The InChIKey is FQXUQXFKARJVPE-WOJNGRSISA-N. The full InChI is InChI=1S/C27H21NS3/c1-5-13-22(14-6-1)28-27(31-25-19-11-4-12-20-25)26(30-24-17-9-3-10-18-24)21-29-23-15-7-2-8-16-23/h1-21H/b26-21?,28-27+.
What are the key properties of phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate?
phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate has a molecular weight of 455.67 g/mol, XLogP of 8.93, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enimidothioate is sourced from PubChem (CID 67543051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).