C27H21NS2 — CID 67545329
phenyl N,3-diphenyl-3-phenylsulfanylprop-2-enimidothioate (PubChem CID 67545329) has the molecular formula C27H21NS2 and a molecular weight of 423.61 g/mol. Its IUPAC name is phenyl N,3-diphenyl-3-phenylsulfanylprop-2-enimidothioate.
| Compound Name | phenyl N,3-diphenyl-3-phenylsulfanylprop-2-enimidothioate |
|---|---|
| PubChem CID | 67545329 |
| Molecular Formula | C27H21NS2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | phenyl N,3-diphenyl-3-phenylsulfanylprop-2-enimidothioate |
| SMILES | C(=C(Sc1ccccc1)c1ccccc1)/C(=N/c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C27H21NS2/c1-5-13-22(14-6-1)26(29-24-17-9-3-10-18-24)21-27(28-23-15-7-2-8-16-23)30-25-19-11-4-12-20-25/h1-21H/b26-21?,28-27- |
| InChIKey | RWPHVDVGCRPUHW-YDOFRMSHSA-N |
| XLogP | 8.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|