C24H23NOS — CID 67542945
phenyl (E)-3-(3,4-dimethylphenoxy)-2-methyl-N-phenylprop-2-enimidothioate (PubChem CID 67542945) has the molecular formula C24H23NOS and a molecular weight of 373.52 g/mol. Its IUPAC name is phenyl (E)-3-(3,4-dimethylphenoxy)-2-methyl-N-phenylprop-2-enimidothioate.
| Compound Name | phenyl (E)-3-(3,4-dimethylphenoxy)-2-methyl-N-phenylprop-2-enimidothioate |
|---|---|
| PubChem CID | 67542945 |
| Molecular Formula | C24H23NOS |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | phenyl (E)-3-(3,4-dimethylphenoxy)-2-methyl-N-phenylprop-2-enimidothioate |
| SMILES | CC(=C\Oc1ccc(C)c(C)c1)/C(=N\c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C24H23NOS/c1-18-14-15-22(16-19(18)2)26-17-20(3)24(25-21-10-6-4-7-11-21)27-23-12-8-5-9-13-23/h4-17H,1-3H3/b20-17+,25-24+ |
| InChIKey | NHOLESFVLAYFAI-VPBPTXNESA-N |
| XLogP | 7.11 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|