About (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate
(3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate (PubChem CID 67543764) has the molecular formula C24H23NO2S
and a molecular weight of 389.52 g/mol. Its IUPAC name is (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate.
Molecular Properties
| Compound Name | (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate |
| PubChem CID | 67543764 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate |
| SMILES | COc1ccccc1O/C=C(C)/C(=N\c1ccccc1)Sc1cccc(C)c1 |
| InChI | InChI=1S/C24H23NO2S/c1-18-10-9-13-21(16-18)28-24(25-20-11-5-4-6-12-20)19(2)17-27-23-15-8-7-14-22(23)26-3/h4-17H,1-3H3/b19-17+,25-24+ |
| InChIKey | AFRZODUGIAMLQO-AIHZIKAQSA-N |
| XLogP | 6.81 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate?
The IUPAC name of (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate (CID 67543764) is (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate.
What is the SMILES notation for (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate?
The canonical SMILES for (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate is COc1ccccc1O/C=C(C)/C(=N\c1ccccc1)Sc1cccc(C)c1.
What is the InChIKey of (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate?
The InChIKey is AFRZODUGIAMLQO-AIHZIKAQSA-N. The full InChI is InChI=1S/C24H23NO2S/c1-18-10-9-13-21(16-18)28-24(25-20-11-5-4-6-12-20)19(2)17-27-23-15-8-7-14-22(23)26-3/h4-17H,1-3H3/b19-17+,25-24+.
What are the key properties of (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate?
(3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate has a molecular weight of 389.52 g/mol, XLogP of 6.81, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) (E)-3-(2-methoxyphenoxy)-2-methyl-N-phenylprop-2-enimidothioate is sourced from PubChem (CID 67543764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).