methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate

C16H14O2S2 — CID 67544521

IUPACmethyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate
SMILESCOC(=O)/C(=C\Sc1ccccc1)Sc1ccccc1
InChIInChI=1S/C16H14O2S2/c1-18-16(17)15(20-14-10-6-3-7-11-14)12-19-13-8-4-2-5-9-13/h2-12H,1H3/b15-12+
InChIKeyGVIRUIPEAWMSLK-NTCAYCPXSA-N
MW302.42 g/mol
LogP4.59
Rot. Bonds5

About methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate

methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate (PubChem CID 67544521) has the molecular formula C16H14O2S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate.

Molecular Properties

Compound Namemethyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate
PubChem CID67544521
Molecular FormulaC16H14O2S2
Molecular Weight302.42 g/mol
Exact Mass302.04
IUPAC Namemethyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate
SMILESCOC(=O)/C(=C\Sc1ccccc1)Sc1ccccc1
InChIInChI=1S/C16H14O2S2/c1-18-16(17)15(20-14-10-6-3-7-11-14)12-19-13-8-4-2-5-9-13/h2-12H,1H3/b15-12+
InChIKeyGVIRUIPEAWMSLK-NTCAYCPXSA-N
XLogP4.59
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.42
LogP ≤ 54.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate?
The IUPAC name of methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate (CID 67544521) is methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate.
What is the SMILES notation for methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate?
The canonical SMILES for methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate is COC(=O)/C(=C\Sc1ccccc1)Sc1ccccc1.
What is the InChIKey of methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate?
The InChIKey is GVIRUIPEAWMSLK-NTCAYCPXSA-N. The full InChI is InChI=1S/C16H14O2S2/c1-18-16(17)15(20-14-10-6-3-7-11-14)12-19-13-8-4-2-5-9-13/h2-12H,1H3/b15-12+.
What are the key properties of methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate?
methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate has a molecular weight of 302.42 g/mol, XLogP of 4.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2,3-bis(phenylsulfanyl)prop-2-enoate is sourced from PubChem (CID 67544521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).