C13H12O5S — CID 88607719
(2Z,4Z)-5-hydroxy-6-methoxy-6-oxo-2-phenylsulfanylhexa-2,4-dienoic acid (PubChem CID 88607719) has the molecular formula C13H12O5S and a molecular weight of 280.30 g/mol. Its IUPAC name is (2Z,4Z)-5-hydroxy-6-methoxy-6-oxo-2-phenylsulfanylhexa-2,4-dienoic acid.
| Compound Name | (2Z,4Z)-5-hydroxy-6-methoxy-6-oxo-2-phenylsulfanylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 88607719 |
| Molecular Formula | C13H12O5S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | (2Z,4Z)-5-hydroxy-6-methoxy-6-oxo-2-phenylsulfanylhexa-2,4-dienoic acid |
| SMILES | COC(=O)/C(O)=C/C=C(\Sc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H12O5S/c1-18-13(17)10(14)7-8-11(12(15)16)19-9-5-3-2-4-6-9/h2-8,14H,1H3,(H,15,16)/b10-7-,11-8- |
| InChIKey | KPXIHAHVUOZJLL-DEFDFUCDSA-N |
| XLogP | 2.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|