C14H13NO3S — CID 88607716
ethyl 5-cyano-2-hydroxy-5-phenylsulfanylpenta-2,4-dienoate (PubChem CID 88607716) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is ethyl 5-cyano-2-hydroxy-5-phenylsulfanylpenta-2,4-dienoate.
| Compound Name | ethyl 5-cyano-2-hydroxy-5-phenylsulfanylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 88607716 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | ethyl 5-cyano-2-hydroxy-5-phenylsulfanylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C(O)=CC=C(C#N)Sc1ccccc1 |
| InChI | InChI=1S/C14H13NO3S/c1-2-18-14(17)13(16)9-8-12(10-15)19-11-6-4-3-5-7-11/h3-9,16H,2H2,1H3 |
| InChIKey | NDGYOGQSUQLANH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|