C17H13N3O2 — CID 126419157
ethyl (2E,4E)-2,6-dicyano-7-imino-5-phenylhepta-2,4,6-trienoate (PubChem CID 126419157) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl (2E,4E)-2,6-dicyano-7-imino-5-phenylhepta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E)-2,6-dicyano-7-imino-5-phenylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 126419157 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl (2E,4E)-2,6-dicyano-7-imino-5-phenylhepta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C(C#N)=C/C=C(/C(=C=N)C#N)c1ccccc1 |
| InChI | InChI=1S/C17H13N3O2/c1-2-22-17(21)14(10-18)8-9-16(15(11-19)12-20)13-6-4-3-5-7-13/h3-9,19H,2H2,1H3/b14-8+,16-9+ |
| InChIKey | BGBLKUYOZLDTGV-JTHWEQIXSA-N |
| XLogP | 2.78 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|