C18H14N3O3- — CID 4150944
[2,6-dicyano-7-ethoxy-3-(4-methoxyphenyl)-7-oxohepta-1,3,5-trienylidene]azanide (PubChem CID 4150944) has the molecular formula C18H14N3O3- and a molecular weight of 320.33 g/mol. Its IUPAC name is [2,6-dicyano-7-ethoxy-3-(4-methoxyphenyl)-7-oxohepta-1,3,5-trienylidene]azanide.
| Compound Name | [2,6-dicyano-7-ethoxy-3-(4-methoxyphenyl)-7-oxohepta-1,3,5-trienylidene]azanide |
|---|---|
| PubChem CID | 4150944 |
| Molecular Formula | C18H14N3O3- |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [2,6-dicyano-7-ethoxy-3-(4-methoxyphenyl)-7-oxohepta-1,3,5-trienylidene]azanide |
| SMILES | CCOC(=O)C(C#N)=CC=C(C(=C=[N-])C#N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H14N3O3/c1-3-24-18(22)14(10-19)6-9-17(15(11-20)12-21)13-4-7-16(23-2)8-5-13/h4-9H,3H2,1-2H3/q-1 |
| InChIKey | NRLICRPMDIXIQL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 105.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|