C18H21NO3 — CID 139616599
(2Z,4E)-2-cyano-5-(4-methoxyphenyl)deca-2,4-dienoic acid (PubChem CID 139616599) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (2Z,4E)-2-cyano-5-(4-methoxyphenyl)deca-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-cyano-5-(4-methoxyphenyl)deca-2,4-dienoic acid |
|---|---|
| PubChem CID | 139616599 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2Z,4E)-2-cyano-5-(4-methoxyphenyl)deca-2,4-dienoic acid |
| SMILES | CCCCC/C(=C\C=C(\C#N)C(=O)O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-3-4-5-6-14(7-8-16(13-19)18(20)21)15-9-11-17(22-2)12-10-15/h7-12H,3-6H2,1-2H3,(H,20,21)/b14-7+,16-8- |
| InChIKey | UEAAEZYEANHBCU-RDJHAYMASA-N |
| XLogP | 4.19 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|