C17H23NO2 — CID 57201086
5-(4-methoxyphenyl)deca-2,4-dienamide (PubChem CID 57201086) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)deca-2,4-dienamide.
| Compound Name | 5-(4-methoxyphenyl)deca-2,4-dienamide |
|---|---|
| PubChem CID | 57201086 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 5-(4-methoxyphenyl)deca-2,4-dienamide |
| SMILES | CCCCCC(=CC=CC(N)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H23NO2/c1-3-4-5-7-14(8-6-9-17(18)19)15-10-12-16(20-2)13-11-15/h6,8-13H,3-5,7H2,1-2H3,(H2,18,19) |
| InChIKey | JJPXAUYFTRZCPD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|