C27H37N3O2 — CID 22155183
(2E,4E)-5-(4-methoxyphenyl)-N-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]undeca-2,4-dienamide (PubChem CID 22155183) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is (2E,4E)-5-(4-methoxyphenyl)-N-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]undeca-2,4-dienamide.
| Compound Name | (2E,4E)-5-(4-methoxyphenyl)-N-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]undeca-2,4-dienamide |
|---|---|
| PubChem CID | 22155183 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | (2E,4E)-5-(4-methoxyphenyl)-N-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]undeca-2,4-dienamide |
| SMILES | CCCCCC/C(=C\C=C\C(=O)NCCN(C)Cc1cccnc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H37N3O2/c1-4-5-6-7-11-24(25-14-16-26(32-3)17-15-25)12-8-13-27(31)29-19-20-30(2)22-23-10-9-18-28-21-23/h8-10,12-18,21H,4-7,11,19-20,22H2,1-3H3,(H,29,31)/b13-8+,24-12+ |
| InChIKey | NDTPKCRTLWNMKA-NRCQUQFTSA-N |
| XLogP | 5.25 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|