C31H30N2O3 — CID 14347375
(2E)-N-(3-isoquinolin-8-ylpropyl)-5,5-bis(4-methoxyphenyl)penta-2,4-dienamide (PubChem CID 14347375) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is (2E)-N-(3-isoquinolin-8-ylpropyl)-5,5-bis(4-methoxyphenyl)penta-2,4-dienamide.
| Compound Name | (2E)-N-(3-isoquinolin-8-ylpropyl)-5,5-bis(4-methoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 14347375 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (2E)-N-(3-isoquinolin-8-ylpropyl)-5,5-bis(4-methoxyphenyl)penta-2,4-dienamide |
| SMILES | COc1ccc(C(=C/C=C/C(=O)NCCCc2cccc3ccncc23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O3/c1-35-27-15-11-25(12-16-27)29(26-13-17-28(36-2)18-14-26)9-4-10-31(34)33-20-5-8-23-6-3-7-24-19-21-32-22-30(23)24/h3-4,6-7,9-19,21-22H,5,8,20H2,1-2H3,(H,33,34)/b10-4+ |
| InChIKey | ROOBLDZHZFHRDZ-ONNFQVAWSA-N |
| XLogP | 5.99 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|