C19H18O3 — CID 54355919
methyl 5-(4-methoxyphenyl)-5-phenylpenta-2,4-dienoate (PubChem CID 54355919) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl 5-(4-methoxyphenyl)-5-phenylpenta-2,4-dienoate.
| Compound Name | methyl 5-(4-methoxyphenyl)-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 54355919 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl 5-(4-methoxyphenyl)-5-phenylpenta-2,4-dienoate |
| SMILES | COC(=O)C=CC=C(c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H18O3/c1-21-17-13-11-16(12-14-17)18(9-6-10-19(20)22-2)15-7-4-3-5-8-15/h3-14H,1-2H3 |
| InChIKey | UJBWSYUILXFCOI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|