C23H18N2O5 — CID 14347452
(4-nitrophenyl) (2E,4Z)-5-(4-methoxyphenyl)-5-pyridin-3-ylpenta-2,4-dienoate (PubChem CID 14347452) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is (4-nitrophenyl) (2E,4Z)-5-(4-methoxyphenyl)-5-pyridin-3-ylpenta-2,4-dienoate.
| Compound Name | (4-nitrophenyl) (2E,4Z)-5-(4-methoxyphenyl)-5-pyridin-3-ylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 14347452 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (4-nitrophenyl) (2E,4Z)-5-(4-methoxyphenyl)-5-pyridin-3-ylpenta-2,4-dienoate |
| SMILES | COc1ccc(/C(=C/C=C/C(=O)Oc2ccc([N+](=O)[O-])cc2)c2cccnc2)cc1 |
| InChI | InChI=1S/C23H18N2O5/c1-29-20-11-7-17(8-12-20)22(18-4-3-15-24-16-18)5-2-6-23(26)30-21-13-9-19(10-14-21)25(27)28/h2-16H,1H3/b6-2+,22-5- |
| InChIKey | PRHURYQDNMQPEL-DOPYAWRWSA-N |
| XLogP | 4.59 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|