C25H21NO6 — CID 14347314
(4-nitrophenyl) (2E)-5,5-bis(3-methoxyphenyl)penta-2,4-dienoate (PubChem CID 14347314) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is (4-nitrophenyl) (2E)-5,5-bis(3-methoxyphenyl)penta-2,4-dienoate.
| Compound Name | (4-nitrophenyl) (2E)-5,5-bis(3-methoxyphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 14347314 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (4-nitrophenyl) (2E)-5,5-bis(3-methoxyphenyl)penta-2,4-dienoate |
| SMILES | COc1cccc(C(=C/C=C/C(=O)Oc2ccc([N+](=O)[O-])cc2)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C25H21NO6/c1-30-22-8-3-6-18(16-22)24(19-7-4-9-23(17-19)31-2)10-5-11-25(27)32-21-14-12-20(13-15-21)26(28)29/h3-17H,1-2H3/b11-5+ |
| InChIKey | JPSWWNZXKKSZMH-VZUCSPMQSA-N |
| XLogP | 5.21 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|