C26H23NO6 — CID 70374210
(4-nitrophenyl) (E)-3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]prop-2-enoate (PubChem CID 70374210) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is (4-nitrophenyl) (E)-3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]prop-2-enoate.
| Compound Name | (4-nitrophenyl) (E)-3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]prop-2-enoate |
|---|---|
| PubChem CID | 70374210 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (4-nitrophenyl) (E)-3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]prop-2-enoate |
| SMILES | COc1cccc(C2(c3cccc(OC)c3)C[C@@H]2/C=C/C(=O)Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C26H23NO6/c1-31-23-7-3-5-18(15-23)26(19-6-4-8-24(16-19)32-2)17-20(26)9-14-25(28)33-22-12-10-21(11-13-22)27(29)30/h3-16,20H,17H2,1-2H3/b14-9+/t20-/m0/s1 |
| InChIKey | LQHGXVPWDJLUGH-PCLFDXGNSA-N |
| XLogP | 5.08 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|