C28H31N3O3 — CID 22840518
(E)-3-[(1S)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-(4-pyrimidin-5-ylbutyl)prop-2-enamide (PubChem CID 22840518) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is (E)-3-[(1S)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-(4-pyrimidin-5-ylbutyl)prop-2-enamide.
| Compound Name | (E)-3-[(1S)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-(4-pyrimidin-5-ylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 22840518 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (E)-3-[(1S)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-(4-pyrimidin-5-ylbutyl)prop-2-enamide |
| SMILES | COc1cccc(C2(c3cccc(OC)c3)C[C@H]2/C=C/C(=O)NCCCCc2cncnc2)c1 |
| InChI | InChI=1S/C28H31N3O3/c1-33-25-10-5-8-22(15-25)28(23-9-6-11-26(16-23)34-2)17-24(28)12-13-27(32)31-14-4-3-7-21-18-29-20-30-19-21/h5-6,8-13,15-16,18-20,24H,3-4,7,14,17H2,1-2H3,(H,31,32)/b13-12+/t24-/m1/s1 |
| InChIKey | ICJSAVGSYAHHBA-JHUUHBRDSA-N |
| XLogP | 4.50 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|