C26H27N3O — CID 57010881
3-[(1S)-2,2-diphenylcyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide (PubChem CID 57010881) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-[(1S)-2,2-diphenylcyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide.
| Compound Name | 3-[(1S)-2,2-diphenylcyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 57010881 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 3-[(1S)-2,2-diphenylcyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide |
| SMILES | O=C(C=C[C@@H]1CC1(c1ccccc1)c1ccccc1)NCCCCc1cccnn1 |
| InChI | InChI=1S/C26H27N3O/c30-25(27-18-8-7-14-24-15-9-19-28-29-24)17-16-23-20-26(23,21-10-3-1-4-11-21)22-12-5-2-6-13-22/h1-6,9-13,15-17,19,23H,7-8,14,18,20H2,(H,27,30)/t23-/m1/s1 |
| InChIKey | HETALBMKMPAFFQ-HSZRJFAPSA-N |
| XLogP | 4.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|