C20H20O2 — CID 14347535
ethyl (Z)-3-[(1R)-2,2-diphenylcyclopropyl]prop-2-enoate (PubChem CID 14347535) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl (Z)-3-[(1R)-2,2-diphenylcyclopropyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(1R)-2,2-diphenylcyclopropyl]prop-2-enoate |
|---|---|
| PubChem CID | 14347535 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | ethyl (Z)-3-[(1R)-2,2-diphenylcyclopropyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20O2/c1-2-22-19(21)14-13-18-15-20(18,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-14,18H,2,15H2,1H3/b14-13-/t18-/m0/s1 |
| InChIKey | KMDHEOWYZAMNNZ-HWOXTHGCSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|