C13H15NO2 — CID 102171774
ethyl (E)-3-[(2R,3R)-3-phenylaziridin-2-yl]prop-2-enoate (PubChem CID 102171774) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3R)-3-phenylaziridin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3R)-3-phenylaziridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102171774 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | ethyl (E)-3-[(2R,3R)-3-phenylaziridin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c1-2-16-12(15)9-8-11-13(14-11)10-6-4-3-5-7-10/h3-9,11,13-14H,2H2,1H3/b9-8+/t11-,13-/m1/s1 |
| InChIKey | NFEXWQMZIYYWNY-UULPFXLMSA-N |
| XLogP | 1.82 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|