C13H13NO3 — CID 174787391
ethyl (E)-3-(2-oxo-1,3-dihydroindol-3-yl)prop-2-enoate (PubChem CID 174787391) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is ethyl (E)-3-(2-oxo-1,3-dihydroindol-3-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2-oxo-1,3-dihydroindol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 174787391 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | ethyl (E)-3-(2-oxo-1,3-dihydroindol-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C13H13NO3/c1-2-17-12(15)8-7-10-9-5-3-4-6-11(9)14-13(10)16/h3-8,10H,2H2,1H3,(H,14,16)/b8-7+ |
| InChIKey | RSXKWVJAOMUCPA-BQYQJAHWSA-N |
| XLogP | 1.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|