C18H19NO3 — CID 169232063
ethyl (E)-3-[(1'R,3R)-2-oxospiro[1H-indole-3,5'-cyclohex-2-ene]-1'-yl]prop-2-enoate (PubChem CID 169232063) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl (E)-3-[(1'R,3R)-2-oxospiro[1H-indole-3,5'-cyclohex-2-ene]-1'-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(1'R,3R)-2-oxospiro[1H-indole-3,5'-cyclohex-2-ene]-1'-yl]prop-2-enoate |
|---|---|
| PubChem CID | 169232063 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl (E)-3-[(1'R,3R)-2-oxospiro[1H-indole-3,5'-cyclohex-2-ene]-1'-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1C=CC[C@]2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H19NO3/c1-2-22-16(20)10-9-13-6-5-11-18(12-13)14-7-3-4-8-15(14)19-17(18)21/h3-10,13H,2,11-12H2,1H3,(H,19,21)/b10-9+/t13-,18-/m1/s1 |
| InChIKey | LCVIMGMLFBEKJI-VASKQELCSA-N |
| XLogP | 2.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|