C31H32O4Se — CID 101241022
diethyl (2E)-2-[(2,2-diphenylcyclopropyl)methylidene]-4-phenylselanylpentanedioate (PubChem CID 101241022) has the molecular formula C31H32O4Se and a molecular weight of 547.55 g/mol. Its IUPAC name is diethyl (2E)-2-[(2,2-diphenylcyclopropyl)methylidene]-4-phenylselanylpentanedioate.
| Compound Name | diethyl (2E)-2-[(2,2-diphenylcyclopropyl)methylidene]-4-phenylselanylpentanedioate |
|---|---|
| PubChem CID | 101241022 |
| Molecular Formula | C31H32O4Se |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | diethyl (2E)-2-[(2,2-diphenylcyclopropyl)methylidene]-4-phenylselanylpentanedioate |
| SMILES | CCOC(=O)/C(=C/C1CC1(c1ccccc1)c1ccccc1)CC([Se]c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C31H32O4Se/c1-3-34-29(32)23(21-28(30(33)35-4-2)36-27-18-12-7-13-19-27)20-26-22-31(26,24-14-8-5-9-15-24)25-16-10-6-11-17-25/h5-20,26,28H,3-4,21-22H2,1-2H3/b23-20+ |
| InChIKey | KNIZHSVXABVSSG-BSYVCWPDSA-N |
| XLogP | 5.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|