C25H28O4Se2 — CID 10674221
diethyl (E,7Z)-2-phenylselanyl-7-(phenylselanylmethylidene)oct-4-enedioate (PubChem CID 10674221) has the molecular formula C25H28O4Se2 and a molecular weight of 550.42 g/mol. Its IUPAC name is diethyl (E,7Z)-2-phenylselanyl-7-(phenylselanylmethylidene)oct-4-enedioate.
| Compound Name | diethyl (E,7Z)-2-phenylselanyl-7-(phenylselanylmethylidene)oct-4-enedioate |
|---|---|
| PubChem CID | 10674221 |
| Molecular Formula | C25H28O4Se2 |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | diethyl (E,7Z)-2-phenylselanyl-7-(phenylselanylmethylidene)oct-4-enedioate |
| SMILES | CCOC(=O)/C(=C\[Se]c1ccccc1)C/C=C/CC([Se]c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C25H28O4Se2/c1-3-28-24(26)20(19-30-21-14-7-5-8-15-21)13-11-12-18-23(25(27)29-4-2)31-22-16-9-6-10-17-22/h5-12,14-17,19,23H,3-4,13,18H2,1-2H3/b12-11+,20-19- |
| InChIKey | BXVCLYZAIYXJIW-SEKJBOIESA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|