C26H25NO2Se2 — CID 11432683
ethyl (E)-2-[N-(2,6-dimethylphenyl)-C-phenylselanylcarbonimidoyl]-3-phenylselanylprop-2-enoate (PubChem CID 11432683) has the molecular formula C26H25NO2Se2 and a molecular weight of 541.41 g/mol. Its IUPAC name is ethyl (E)-2-[N-(2,6-dimethylphenyl)-C-phenylselanylcarbonimidoyl]-3-phenylselanylprop-2-enoate.
| Compound Name | ethyl (E)-2-[N-(2,6-dimethylphenyl)-C-phenylselanylcarbonimidoyl]-3-phenylselanylprop-2-enoate |
|---|---|
| PubChem CID | 11432683 |
| Molecular Formula | C26H25NO2Se2 |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 543.02 |
| IUPAC Name | ethyl (E)-2-[N-(2,6-dimethylphenyl)-C-phenylselanylcarbonimidoyl]-3-phenylselanylprop-2-enoate |
| SMILES | CCOC(=O)C(=C\[Se]c1ccccc1)/C(=N/c1c(C)cccc1C)[Se]c1ccccc1 |
| InChI | InChI=1S/C26H25NO2Se2/c1-4-29-26(28)23(18-30-21-14-7-5-8-15-21)25(31-22-16-9-6-10-17-22)27-24-19(2)12-11-13-20(24)3/h5-18H,4H2,1-3H3/b23-18-,27-25- |
| InChIKey | MKAIUJOPEKCNBV-FALKZDQASA-N |
| XLogP | 3.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|