C24H29NO3 — CID 160842771
ethyl 3-(2,6-dimethylphenyl)imino-2-[hydroxy-(2,4,6-trimethylphenyl)methylidene]butanoate (PubChem CID 160842771) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is ethyl 3-(2,6-dimethylphenyl)imino-2-[hydroxy-(2,4,6-trimethylphenyl)methylidene]butanoate.
| Compound Name | ethyl 3-(2,6-dimethylphenyl)imino-2-[hydroxy-(2,4,6-trimethylphenyl)methylidene]butanoate |
|---|---|
| PubChem CID | 160842771 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | ethyl 3-(2,6-dimethylphenyl)imino-2-[hydroxy-(2,4,6-trimethylphenyl)methylidene]butanoate |
| SMILES | CCOC(=O)C(=C(O)c1c(C)cc(C)cc1C)/C(C)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C24H29NO3/c1-8-28-24(27)21(19(7)25-22-15(3)10-9-11-16(22)4)23(26)20-17(5)12-14(2)13-18(20)6/h9-13,26H,8H2,1-7H3/b23-21?,25-19+ |
| InChIKey | VREKVZBHDWVDMW-DRUOZYJYSA-N |
| XLogP | 5.85 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|