C26H31O5P — CID 123855205
ethyl 3-bis(2,4,6-trimethylbenzoyl)phosphoryl-2-methylprop-2-enoate (PubChem CID 123855205) has the molecular formula C26H31O5P and a molecular weight of 454.50 g/mol. Its IUPAC name is ethyl 3-bis(2,4,6-trimethylbenzoyl)phosphoryl-2-methylprop-2-enoate.
| Compound Name | ethyl 3-bis(2,4,6-trimethylbenzoyl)phosphoryl-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123855205 |
| Molecular Formula | C26H31O5P |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | ethyl 3-bis(2,4,6-trimethylbenzoyl)phosphoryl-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=CP(=O)(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C26H31O5P/c1-9-31-24(27)21(8)14-32(30,25(28)22-17(4)10-15(2)11-18(22)5)26(29)23-19(6)12-16(3)13-20(23)7/h10-14H,9H2,1-8H3 |
| InChIKey | DDDNYQOQHQSWFA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|