C24H28ClO5P — CID 140521276
2-chloroethyl 2-bis(2,4,6-trimethylbenzoyl)phosphorylacetate (PubChem CID 140521276) has the molecular formula C24H28ClO5P and a molecular weight of 462.91 g/mol. Its IUPAC name is 2-chloroethyl 2-bis(2,4,6-trimethylbenzoyl)phosphorylacetate.
| Compound Name | 2-chloroethyl 2-bis(2,4,6-trimethylbenzoyl)phosphorylacetate |
|---|---|
| PubChem CID | 140521276 |
| Molecular Formula | C24H28ClO5P |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-chloroethyl 2-bis(2,4,6-trimethylbenzoyl)phosphorylacetate |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CC(=O)OCCCl)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H28ClO5P/c1-14-9-16(3)21(17(4)10-14)23(27)31(29,13-20(26)30-8-7-25)24(28)22-18(5)11-15(2)12-19(22)6/h9-12H,7-8,13H2,1-6H3 |
| InChIKey | QSACCZLKDKJSPA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|