C22H24N2O3 — CID 134873452
ethyl 3-(2,6-dimethylphenyl)imino-2-[(4-methoxyphenyl)iminomethylidene]butanoate (PubChem CID 134873452) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is ethyl 3-(2,6-dimethylphenyl)imino-2-[(4-methoxyphenyl)iminomethylidene]butanoate.
| Compound Name | ethyl 3-(2,6-dimethylphenyl)imino-2-[(4-methoxyphenyl)iminomethylidene]butanoate |
|---|---|
| PubChem CID | 134873452 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | ethyl 3-(2,6-dimethylphenyl)imino-2-[(4-methoxyphenyl)iminomethylidene]butanoate |
| SMILES | CCOC(=O)C(=C=Nc1ccc(OC)cc1)/C(C)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C22H24N2O3/c1-6-27-22(25)20(14-23-18-10-12-19(26-5)13-11-18)17(4)24-21-15(2)8-7-9-16(21)3/h7-13H,6H2,1-5H3/b24-17+ |
| InChIKey | NQESOCNSIPSPAH-JJIBRWJFSA-N |
| XLogP | 4.90 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|