C34H44N2O6 — CID 177404582
ethyl (Z)-2-[[(1R,2R)-2-[[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-hydroxybut-2-enoate (PubChem CID 177404582) has the molecular formula C34H44N2O6 and a molecular weight of 576.73 g/mol. Its IUPAC name is ethyl (Z)-2-[[(1R,2R)-2-[[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z)-2-[[(1R,2R)-2-[[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 177404582 |
| Molecular Formula | C34H44N2O6 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | ethyl (Z)-2-[[(1R,2R)-2-[[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]amino]-1,2-bis(2,4,6-trimethylphenyl)ethyl]iminomethyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/C=N/[C@H](c1c(C)cc(C)cc1C)[C@H](/N=C/C(C(=O)OCC)=C(/C)O)c1c(C)cc(C)cc1C)=C(/C)O |
| InChI | InChI=1S/C34H44N2O6/c1-11-41-33(39)27(25(9)37)17-35-31(29-21(5)13-19(3)14-22(29)6)32(30-23(7)15-20(4)16-24(30)8)36-18-28(26(10)38)34(40)42-12-2/h13-18,31-32,37-38H,11-12H2,1-10H3/b27-25-,28-26+,35-17+,36-18+/t31-,32-/m1/s1 |
| InChIKey | YYDQNOUDIOYCJO-KZHOQGAUSA-N |
| XLogP | 7.25 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|