C14H12Cl3NO5 — CID 163692039
2,3,6-trichloro-5-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoic acid (PubChem CID 163692039) has the molecular formula C14H12Cl3NO5 and a molecular weight of 380.61 g/mol. Its IUPAC name is 2,3,6-trichloro-5-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoic acid.
| Compound Name | 2,3,6-trichloro-5-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoic acid |
|---|---|
| PubChem CID | 163692039 |
| Molecular Formula | C14H12Cl3NO5 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 2,3,6-trichloro-5-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoic acid |
| SMILES | CCOC(=O)C(/C=N/c1cc(Cl)c(Cl)c(C(=O)O)c1Cl)=C(C)O |
| InChI | InChI=1S/C14H12Cl3NO5/c1-3-23-14(22)7(6(2)19)5-18-9-4-8(15)11(16)10(12(9)17)13(20)21/h4-5,19H,3H2,1-2H3,(H,20,21)/b7-6?,18-5+ |
| InChIKey | HNTCSOHFRPMZTK-FWMDDDPBSA-N |
| XLogP | 4.44 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|