C17H19Cl2NO5 — CID 173452048
propan-2-yl 2,5-dichloro-3-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoate (PubChem CID 173452048) has the molecular formula C17H19Cl2NO5 and a molecular weight of 388.25 g/mol. Its IUPAC name is propan-2-yl 2,5-dichloro-3-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoate.
| Compound Name | propan-2-yl 2,5-dichloro-3-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoate |
|---|---|
| PubChem CID | 173452048 |
| Molecular Formula | C17H19Cl2NO5 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | propan-2-yl 2,5-dichloro-3-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoate |
| SMILES | CCOC(=O)C(/C=N/c1cc(Cl)cc(C(=O)OC(C)C)c1Cl)=C(C)O |
| InChI | InChI=1S/C17H19Cl2NO5/c1-5-24-16(22)13(10(4)21)8-20-14-7-11(18)6-12(15(14)19)17(23)25-9(2)3/h6-9,21H,5H2,1-4H3/b13-10?,20-8+ |
| InChIKey | KVLCIGWBWGPHKF-AANXWMPASA-N |
| XLogP | 4.66 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|