C18H21Cl2NO5 — CID 173452090
propyl 2,6-dichloro-3-[(3-hydroxy-2-propoxycarbonylbut-2-enylidene)amino]benzoate (PubChem CID 173452090) has the molecular formula C18H21Cl2NO5 and a molecular weight of 402.27 g/mol. Its IUPAC name is propyl 2,6-dichloro-3-[(3-hydroxy-2-propoxycarbonylbut-2-enylidene)amino]benzoate.
| Compound Name | propyl 2,6-dichloro-3-[(3-hydroxy-2-propoxycarbonylbut-2-enylidene)amino]benzoate |
|---|---|
| PubChem CID | 173452090 |
| Molecular Formula | C18H21Cl2NO5 |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | propyl 2,6-dichloro-3-[(3-hydroxy-2-propoxycarbonylbut-2-enylidene)amino]benzoate |
| SMILES | CCCOC(=O)C(/C=N/c1ccc(Cl)c(C(=O)OCCC)c1Cl)=C(C)O |
| InChI | InChI=1S/C18H21Cl2NO5/c1-4-8-25-17(23)12(11(3)22)10-21-14-7-6-13(19)15(16(14)20)18(24)26-9-5-2/h6-7,10,22H,4-5,8-9H2,1-3H3/b12-11?,21-10+ |
| InChIKey | QDGLNVXUVKRDDK-HJNGOTHUSA-N |
| XLogP | 5.05 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|