C17H20Cl2N2O4 — CID 173451854
propyl 2-[[2,4-dichloro-3-(ethylcarbamoyl)phenyl]iminomethyl]-3-hydroxybut-2-enoate (PubChem CID 173451854) has the molecular formula C17H20Cl2N2O4 and a molecular weight of 387.26 g/mol. Its IUPAC name is propyl 2-[[2,4-dichloro-3-(ethylcarbamoyl)phenyl]iminomethyl]-3-hydroxybut-2-enoate.
| Compound Name | propyl 2-[[2,4-dichloro-3-(ethylcarbamoyl)phenyl]iminomethyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 173451854 |
| Molecular Formula | C17H20Cl2N2O4 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | propyl 2-[[2,4-dichloro-3-(ethylcarbamoyl)phenyl]iminomethyl]-3-hydroxybut-2-enoate |
| SMILES | CCCOC(=O)C(/C=N/c1ccc(Cl)c(C(=O)NCC)c1Cl)=C(C)O |
| InChI | InChI=1S/C17H20Cl2N2O4/c1-4-8-25-17(24)11(10(3)22)9-21-13-7-6-12(18)14(15(13)19)16(23)20-5-2/h6-7,9,22H,4-5,8H2,1-3H3,(H,20,23)/b11-10?,21-9+ |
| InChIKey | JYMNNLVJZAOUPD-ZJNIJFDISA-N |
| XLogP | 4.23 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|