C15H15Cl2NO5 — CID 54528105
2,6-dichloro-3-[(3-oxo-2-propoxycarbonylbutylidene)amino]benzoic acid (PubChem CID 54528105) has the molecular formula C15H15Cl2NO5 and a molecular weight of 360.19 g/mol. Its IUPAC name is 2,6-dichloro-3-[(3-oxo-2-propoxycarbonylbutylidene)amino]benzoic acid.
| Compound Name | 2,6-dichloro-3-[(3-oxo-2-propoxycarbonylbutylidene)amino]benzoic acid |
|---|---|
| PubChem CID | 54528105 |
| Molecular Formula | C15H15Cl2NO5 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2,6-dichloro-3-[(3-oxo-2-propoxycarbonylbutylidene)amino]benzoic acid |
| SMILES | CCCOC(=O)C(/C=N/c1ccc(Cl)c(C(=O)O)c1Cl)C(C)=O |
| InChI | InChI=1S/C15H15Cl2NO5/c1-3-6-23-15(22)9(8(2)19)7-18-11-5-4-10(16)12(13(11)17)14(20)21/h4-5,7,9H,3,6H2,1-2H3,(H,20,21)/b18-7+ |
| InChIKey | YUNYQUWPXNVUJA-CNHKJKLMSA-N |
| XLogP | 3.55 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|