About propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate
propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate (PubChem CID 54000844) has the molecular formula C16H18Cl2N2O4
and a molecular weight of 373.24 g/mol. Its IUPAC name is propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate |
| PubChem CID | 54000844 |
| Molecular Formula | C16H18Cl2N2O4 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate |
| SMILES | CNC(=O)c1c(Cl)ccc(/N=C/C(C(C)=O)C(=O)OC(C)C)c1Cl |
| InChI | InChI=1S/C16H18Cl2N2O4/c1-8(2)24-16(23)10(9(3)21)7-20-12-6-5-11(17)13(14(12)18)15(22)19-4/h5-8,10H,1-4H3,(H,19,22)/b20-7+ |
| InChIKey | KLMDCEKAMOWFBD-IFRROFPPSA-N |
| XLogP | 3.21 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate?
The IUPAC name of propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate (CID 54000844) is propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate.
What is the SMILES notation for propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate?
The canonical SMILES for propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate is CNC(=O)c1c(Cl)ccc(/N=C/C(C(C)=O)C(=O)OC(C)C)c1Cl.
What is the InChIKey of propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate?
The InChIKey is KLMDCEKAMOWFBD-IFRROFPPSA-N. The full InChI is InChI=1S/C16H18Cl2N2O4/c1-8(2)24-16(23)10(9(3)21)7-20-12-6-5-11(17)13(14(12)18)15(22)19-4/h5-8,10H,1-4H3,(H,19,22)/b20-7+.
What are the key properties of propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate?
propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate has a molecular weight of 373.24 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[[2,4-dichloro-3-(methylcarbamoyl)phenyl]iminomethyl]-3-oxobutanoate is sourced from PubChem (CID 54000844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).