C17H18Cl3NO5 — CID 173451836
propan-2-yl 2,3,6-trichloro-5-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoate (PubChem CID 173451836) has the molecular formula C17H18Cl3NO5 and a molecular weight of 422.69 g/mol. Its IUPAC name is propan-2-yl 2,3,6-trichloro-5-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoate.
| Compound Name | propan-2-yl 2,3,6-trichloro-5-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoate |
|---|---|
| PubChem CID | 173451836 |
| Molecular Formula | C17H18Cl3NO5 |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | propan-2-yl 2,3,6-trichloro-5-[(2-ethoxycarbonyl-3-hydroxybut-2-enylidene)amino]benzoate |
| SMILES | CCOC(=O)C(/C=N/c1cc(Cl)c(Cl)c(C(=O)OC(C)C)c1Cl)=C(C)O |
| InChI | InChI=1S/C17H18Cl3NO5/c1-5-25-16(23)10(9(4)22)7-21-12-6-11(18)14(19)13(15(12)20)17(24)26-8(2)3/h6-8,22H,5H2,1-4H3/b10-9?,21-7+ |
| InChIKey | NBPHVSDIFYLCLN-FYRSIFJWSA-N |
| XLogP | 5.31 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|