C15H13Cl3N2O4 — CID 54057218
ethyl 2,3,6-trichloro-5-[(2-cyano-3-ethoxy-3-oxopropylidene)amino]benzoate (PubChem CID 54057218) has the molecular formula C15H13Cl3N2O4 and a molecular weight of 391.64 g/mol. Its IUPAC name is ethyl 2,3,6-trichloro-5-[(2-cyano-3-ethoxy-3-oxopropylidene)amino]benzoate.
| Compound Name | ethyl 2,3,6-trichloro-5-[(2-cyano-3-ethoxy-3-oxopropylidene)amino]benzoate |
|---|---|
| PubChem CID | 54057218 |
| Molecular Formula | C15H13Cl3N2O4 |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | ethyl 2,3,6-trichloro-5-[(2-cyano-3-ethoxy-3-oxopropylidene)amino]benzoate |
| SMILES | CCOC(=O)c1c(Cl)c(Cl)cc(/N=C/C(C#N)C(=O)OCC)c1Cl |
| InChI | InChI=1S/C15H13Cl3N2O4/c1-3-23-14(21)8(6-19)7-20-10-5-9(16)12(17)11(13(10)18)15(22)24-4-2/h5,7-8H,3-4H2,1-2H3/b20-7+ |
| InChIKey | LXCDFNJFMGFBCF-IFRROFPPSA-N |
| XLogP | 4.23 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|