C15H16ClN3O3 — CID 54421409
ethyl 3-[2-chloro-3-(ethylcarbamoyl)phenyl]imino-2-cyanopropanoate (PubChem CID 54421409) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is ethyl 3-[2-chloro-3-(ethylcarbamoyl)phenyl]imino-2-cyanopropanoate.
| Compound Name | ethyl 3-[2-chloro-3-(ethylcarbamoyl)phenyl]imino-2-cyanopropanoate |
|---|---|
| PubChem CID | 54421409 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | ethyl 3-[2-chloro-3-(ethylcarbamoyl)phenyl]imino-2-cyanopropanoate |
| SMILES | CCNC(=O)c1cccc(/N=C/C(C#N)C(=O)OCC)c1Cl |
| InChI | InChI=1S/C15H16ClN3O3/c1-3-18-14(20)11-6-5-7-12(13(11)16)19-9-10(8-17)15(21)22-4-2/h5-7,9-10H,3-4H2,1-2H3,(H,18,20)/b19-9+ |
| InChIKey | WBBJDLMPSQHSNB-DJKKODMXSA-N |
| XLogP | 2.49 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|