C15H16ClN3O3 — CID 8821600
ethyl (2R)-3-[2-(3-chloro-2-methylanilino)-2-oxoethyl]imino-2-cyanopropanoate (PubChem CID 8821600) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is ethyl (2R)-3-[2-(3-chloro-2-methylanilino)-2-oxoethyl]imino-2-cyanopropanoate.
| Compound Name | ethyl (2R)-3-[2-(3-chloro-2-methylanilino)-2-oxoethyl]imino-2-cyanopropanoate |
|---|---|
| PubChem CID | 8821600 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | ethyl (2R)-3-[2-(3-chloro-2-methylanilino)-2-oxoethyl]imino-2-cyanopropanoate |
| SMILES | CCOC(=O)[C@@H](C#N)/C=N/CC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C15H16ClN3O3/c1-3-22-15(21)11(7-17)8-18-9-14(20)19-13-6-4-5-12(16)10(13)2/h4-6,8,11H,3,9H2,1-2H3,(H,19,20)/b18-8+/t11-/m0/s1 |
| InChIKey | VGCAQEHZDZIPGK-SXUYUPPPSA-N |
| XLogP | 2.36 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|