C16H21ClN3O2+ — CID 8812554
[(1S)-1-(2-chlorophenyl)-2-[[(2S)-2-cyano-3-ethoxy-3-oxopropylidene]amino]ethyl]-dimethylazanium (PubChem CID 8812554) has the molecular formula C16H21ClN3O2+ and a molecular weight of 322.82 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)-2-[[(2S)-2-cyano-3-ethoxy-3-oxopropylidene]amino]ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)-2-[[(2S)-2-cyano-3-ethoxy-3-oxopropylidene]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8812554 |
| Molecular Formula | C16H21ClN3O2+ |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)-2-[[(2S)-2-cyano-3-ethoxy-3-oxopropylidene]amino]ethyl]-dimethylazanium |
| SMILES | CCOC(=O)[C@H](C#N)/C=N/C[C@H](c1ccccc1Cl)[NH+](C)C |
| InChI | InChI=1S/C16H20ClN3O2/c1-4-22-16(21)12(9-18)10-19-11-15(20(2)3)13-7-5-6-8-14(13)17/h5-8,10,12,15H,4,11H2,1-3H3/p+1/b19-10+/t12-,15-/m1/s1 |
| InChIKey | DZTHHANILASHTD-OVDLRJDPSA-O |
| XLogP | 1.30 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|